CAS 20829-96-3 appears in our catalog under these names: 6-Chloroisatoic anhydride, 98%, 5-Chloro-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 98%, 5-Chloro-1H-benzo[d][1,3]oxazine-2,4-dione, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg, 100g.
5-chloro-1H-3,1-benzoxazine-2,4-dione (CAS 20829-96-3) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 5-chloro-1H-3,1-benzoxazine-2,4-dione. InChIKey: NIGOFAVNIBBNJV-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 5-chloro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | NIGOFAVNIBBNJV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)