CAS 108805-37-4 is the registry number for 5-Chloro-1,2-benzoxazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-1,2-benzoxazole-3-carboxylic acid (CAS 108805-37-4) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 5-chloro-1,2-benzoxazole-3-carboxylic acid. InChIKey: KUDYWISGEFWOJH-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 5-chloro-1,2-benzoxazole-3-carboxylic acid |
| InChIKey | KUDYWISGEFWOJH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NO2)C(=O)O |
Computed by PubChem (NCBI)