Products 1782454-00-5

CAS 1782454-00-5 is the registry number for 7-Chlorobenzo[c]isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-chloro-2,1-benzoxazole-3-carboxylic acid (CAS 1782454-00-5) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 7-chloro-2,1-benzoxazole-3-carboxylic acid. InChIKey: GVDAOXHLLJENHB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4ClNO3
Molecular weight197.57 g/mol
IUPAC name7-chloro-2,1-benzoxazole-3-carboxylic acid
InChIKeyGVDAOXHLLJENHB-UHFFFAOYSA-N
SMILESC1=CC2=C(ON=C2C(=C1)Cl)C(=O)O

Computed by PubChem (NCBI)