CAS 63497-60-9 appears in our catalog under these names: 8-Chloro-1h-benzo[d][1,3]oxazine-2,4-dione, 95%, 8-Chloro-1H-benzo(D)(1,3)oxazine-2,4-dione, 8-Chloro-1H-benzo[d][1,3]oxazine-2,4-dione 95+%, 8-Chloro-1H-benzo[d][1,3]oxazine-2,4-dione, 95%, 95%, 8-Chloro-2-hydroxy-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 2.5g.
8-chloro-1H-3,1-benzoxazine-2,4-dione (CAS 63497-60-9) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 8-chloro-1H-3,1-benzoxazine-2,4-dione. InChIKey: ORYNBDLURYDZFM-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 8-chloro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | ORYNBDLURYDZFM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=O)OC2=O |
Computed by PubChem (NCBI)