Products 28691-49-8
CAS 28691-49-8 appears in our catalog under these names: 6–Chlorobenzo(d)isoxazole–3–carboxylic acid, 6-Chlorobenzo[d]isoxazole-3-carboxylic acid 96%, 6-Chlorobenzo[d]isoxazole-3-carboxylic acid, 96%, 96%, 6-Chlorobenzo[d]isoxazole-3-carboxylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
6-chloro-1,2-benzoxazole-3-carboxylic acid (CAS 28691-49-8) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 6-chloro-1,2-benzoxazole-3-carboxylic acid. InChIKey: NWWICAZKQSVOGE-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 6-chloro-1,2-benzoxazole-3-carboxylic acid |
| InChIKey | NWWICAZKQSVOGE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)ON=C2C(=O)O |
Computed by PubChem (NCBI)