CAS 478148-53-7 appears in our catalog under these names: 7-Chlorofuro[2,3-c]pyridine-5-carboxylic acid, 95%, 7-chlorofuro(2,3-c)pyridine-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
7-chlorofuro[2,3-c]pyridine-5-carboxylic acid (CAS 478148-53-7) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 7-chlorofuro[2,3-c]pyridine-5-carboxylic acid. InChIKey: PXTZUYPPAYUOEY-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 7-chlorofuro[2,3-c]pyridine-5-carboxylic acid |
| InChIKey | PXTZUYPPAYUOEY-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(N=C(C=C21)C(=O)O)Cl |
Computed by PubChem (NCBI)