CAS 86518-08-3 appears in our catalog under these names: 4-Chlorofuro[3,2-c]pyridine-2-carboxylic acid, 95%, 4-Chlorofuro(3,2-c)pyridine-2-carboxylic acid, 95+%, 4–Chlorofuro(3,2–c)pyridine–2–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-chlorofuro[3,2-c]pyridine-2-carboxylic acid (CAS 86518-08-3) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 4-chlorofuro[3,2-c]pyridine-2-carboxylic acid. InChIKey: HTPCVTPLUIZYBR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 4-chlorofuro[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | HTPCVTPLUIZYBR-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1OC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)