CAS 31544-40-8 appears in our catalog under these names: 7-chloro-3,4-dihydro-2h-1,3-benzoxazine-2,4-dione, 95%, 7-Chloro-3,4-dihydro-2H-1,3-benzoxazine-2,4-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 1000mg, 500mg.
7-chloro-1,3-benzoxazine-2,4-dione (CAS 31544-40-8) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 7-chloro-1,3-benzoxazine-2,4-dione. InChIKey: KJWJQOMPJKFLKL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 7-chloro-1,3-benzoxazine-2,4-dione |
| InChIKey | KJWJQOMPJKFLKL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=O)NC2=O |
Computed by PubChem (NCBI)