Products 1314922-85-4

CAS 1314922-85-4 is the registry number for 6-Chlorobenzo[c]isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-chloro-2,1-benzoxazole-3-carboxylic acid (CAS 1314922-85-4) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 6-chloro-2,1-benzoxazole-3-carboxylic acid. InChIKey: FUBIKVSQXOAKLB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4ClNO3
Molecular weight197.57 g/mol
IUPAC name6-chloro-2,1-benzoxazole-3-carboxylic acid
InChIKeyFUBIKVSQXOAKLB-UHFFFAOYSA-N
SMILESC1=CC2=C(ON=C2C=C1Cl)C(=O)O

Computed by PubChem (NCBI)