CAS 49559-65-1 appears in our catalog under these names: 5-Chloro-benzooxazole-2-carboxylic acid, 95%, 5-Chloro-benzooxazole-2-carboxylic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 1mg, 2,5mg, 5mg.
5-chloro-1,3-benzoxazole-2-carboxylic acid (CAS 49559-65-1) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 5-chloro-1,3-benzoxazole-2-carboxylic acid. InChIKey: DYJGNDXUMNGLIT-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 5-chloro-1,3-benzoxazole-2-carboxylic acid |
| InChIKey | DYJGNDXUMNGLIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(O2)C(=O)O |
Computed by PubChem (NCBI)