cas: 10406-05-0 — see every product listed under this CAS number, including other names
5-Chloro-1H-indole-3-carboxylic acid, 98%, 98% (CAS 10406-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118F39-250mg |
| cas | 10406-05-0 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 299.60 Pln | |
| Chemat | 25g | 1072.40 Pln | |
| Chemat | 100g | 4101.20 Pln | |
| Chemat | 10g | 515.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-1H-indole-3-carboxylic acid (CAS 10406-05-0) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloro-1H-indole-3-carboxylic acid. InChIKey: XUDITEOFEQOSAK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloro-1H-indole-3-carboxylic acid |
| InChIKey | XUDITEOFEQOSAK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)