5-Chloro-1H-indole-3-carboxylic acid, 98%
cas: 10406-05-0 — see every product listed under this CAS number, including other names
5-Chloro-1H-indole-3-carboxylic acid, 98% (CAS 10406-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A128510-250mg |
| cas | 10406-05-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 10g | 1104.63 Pln | |
| Ambeed | 25g | 2645.44 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 299.60 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 25g | 1072.40 Pln | |
| Chemat | 100g | 4101.20 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 492.55 Pln | |
| Fluorochem | 10g | 914.28 Pln | |
| Fluorochem | 25g | 1913.93 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 203.29 Pln | |
| BLDpharm | 5g | 708.66 Pln | |
| BLDpharm | 25g | 2846.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-chloro-1H-indole-3-carboxylic acid (CAS 10406-05-0) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 5-chloro-1H-indole-3-carboxylic acid. InChIKey: XUDITEOFEQOSAK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-chloro-1H-indole-3-carboxylic acid |
| InChIKey | XUDITEOFEQOSAK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)