CAS 158580-95-1 appears in our catalog under these names: 6,7-Difluoroindoline-2,3-dione, 95%, 6,7-Difluoroindoline-2,3-dione, 97%, 97%, 6,7-Difluoro-2,3-dihydro-1h-indole-2,3-dione, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
6,7-difluoro-1H-indole-2,3-dione (CAS 158580-95-1) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 6,7-difluoro-1H-indole-2,3-dione. InChIKey: FFHXSUOLKDGHLA-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 6,7-difluoro-1H-indole-2,3-dione |
| InChIKey | FFHXSUOLKDGHLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)F)F |
Computed by PubChem (NCBI)