CAS 2229084-84-6 is the registry number for 1-Ethynyl-2,5-difluoro-4-nitrobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethynyl-2,5-difluoro-4-nitrobenzene (CAS 2229084-84-6) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 1-ethynyl-2,5-difluoro-4-nitrobenzene. InChIKey: JQMYHHSMKBCPAK-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 1-ethynyl-2,5-difluoro-4-nitrobenzene |
| InChIKey | JQMYHHSMKBCPAK-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)