CAS 116570-41-3 appears in our catalog under these names: 5,7-Difluoroindoline-2,3-dione, 95%, 5,7–Difluoroindoline–2,3–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 50mg.
5,7-difluoro-1H-indole-2,3-dione (CAS 116570-41-3) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 5,7-difluoro-1H-indole-2,3-dione. InChIKey: LGOCJGRNNIZUBL-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 5,7-difluoro-1H-indole-2,3-dione |
| InChIKey | LGOCJGRNNIZUBL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)F)F |
Computed by PubChem (NCBI)