CAS 181073-82-5 appears in our catalog under these names: 4–Cyano–2,6–difluorobenzoic acid, 4-Cyano-2,6-difluorobenzoic acid 97%, 4-Cyano-2,6-difluorobenzoic acid, 97%, 97%, 4-Cyano-2,6-difluorobenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4-cyano-2,6-difluorobenzoic acid (CAS 181073-82-5) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 4-cyano-2,6-difluorobenzoic acid. InChIKey: QJDLXGDIYHMIDN-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 4-cyano-2,6-difluorobenzoic acid |
| InChIKey | QJDLXGDIYHMIDN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)C#N |
Computed by PubChem (NCBI)