CAS 774-47-0 appears in our catalog under these names: 5,6-Difluoroisatin, 96%, 5,6-Difluoroindoline-2,3-dione 97%, 5,6-Difluoroindoline-2,3-dione, 97%, 97%, 5,6-Difluoroindoline-2,3-dione, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
5,6-difluoro-1H-indole-2,3-dione (CAS 774-47-0) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 5,6-difluoro-1H-indole-2,3-dione. InChIKey: FQIJOGDQWRLSQW-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 5,6-difluoro-1H-indole-2,3-dione |
| InChIKey | FQIJOGDQWRLSQW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC(=O)C2=O |
Computed by PubChem (NCBI)