CAS 2229517-52-4 is the registry number for 2-Ethynyl-1,3-difluoro-4-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethynyl-1,3-difluoro-4-nitrobenzene (CAS 2229517-52-4) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 2-ethynyl-1,3-difluoro-4-nitrobenzene. InChIKey: ZNQIYSZILKEENB-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 2-ethynyl-1,3-difluoro-4-nitrobenzene |
| InChIKey | ZNQIYSZILKEENB-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=CC(=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)