CAS 177942-39-1 appears in our catalog under these names: 3-Cyano-2,4-difluorobenzoic acid, 95%, 3-Cyano-2,4-difluorobenzoic acid, 98%, 3-Cyano-2,4-difluorobenzoic acid 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
3-cyano-2,4-difluorobenzoic acid (CAS 177942-39-1) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 3-cyano-2,4-difluorobenzoic acid. InChIKey: JCPGMDKZYAHBAC-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 3-cyano-2,4-difluorobenzoic acid |
| InChIKey | JCPGMDKZYAHBAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)C#N)F |
Computed by PubChem (NCBI)