CAS 1378788-81-8 is the registry number for 5-Cyano-2,4-difluorobenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
5-cyano-2,4-difluorobenzoic acid (CAS 1378788-81-8) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 5-cyano-2,4-difluorobenzoic acid. InChIKey: MIUNGSFQFCNQTC-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 5-cyano-2,4-difluorobenzoic acid |
| InChIKey | MIUNGSFQFCNQTC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)F)F)C#N |
Computed by PubChem (NCBI)