CAS 83684-73-5 appears in our catalog under these names: 5,6-Difluoroisoindoline-1,3-dione, 98%, 5,6-difluoroisoindoline-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 2,5g, 250mg.
5,6-difluoroisoindole-1,3-dione (CAS 83684-73-5) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 5,6-difluoroisoindole-1,3-dione. InChIKey: MROUYCSLODQSRN-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 5,6-difluoroisoindole-1,3-dione |
| InChIKey | MROUYCSLODQSRN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)C(=O)NC2=O |
Computed by PubChem (NCBI)