CAS 126674-93-9 appears in our catalog under these names: 4,6–Difluoro–1H–indole–2,3–dione, 4,6-Difluoroisatin, 4,6-Difluoroisatin 95%, 4,6-Difluoro-1H-indole-2,3-dione, 95%, 95%, 4,6-Difluoro-1H-indole-2,3-dione, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 50g, 100g, 1g, 500g.
4,6-difluoro-1H-indole-2,3-dione (CAS 126674-93-9) is a chemical compound with the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. IUPAC name: 4,6-difluoro-1H-indole-2,3-dione. InChIKey: YIVXDNUTNIKQMY-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2 |
|---|---|
| Molecular weight | 183.11 g/mol |
| IUPAC name | 4,6-difluoro-1H-indole-2,3-dione |
| InChIKey | YIVXDNUTNIKQMY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C2=O)F)F |
Computed by PubChem (NCBI)