6-(4-Vinylphenyl)-2,3-dihydrobenzo[b][1,4]dioxine, 95%
cas: 2920875-64-3 — see every product listed under this CAS number, including other names
6-(4-Vinylphenyl)-2,3-dihydrobenzo[b][1,4]dioxine, 95% (CAS 2920875-64-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2978309-50mg |
| cas | 2920875-64-3 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 448.25 Pln | |
| Ambeed | 100mg | 709.69 Pln | |
| Ambeed | 250mg | 1221.44 Pln | |
| Ambeed | 1g | 3168.31 Pln | |
| Chemat | 50mg | 419.60 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1154.00 Pln | |
| Chemat | 1g | 3016.40 Pln | |
| BLDpharm | 50mg | 475.41 Pln | |
| BLDpharm | 100mg | 758.65 Pln | |
| BLDpharm | 250mg | 1314.01 Pln | |
| BLDpharm | 1g | 3413.27 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-(4-ethenylphenyl)-2,3-dihydro-1,4-benzodioxine (CAS 2920875-64-3) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 6-(4-ethenylphenyl)-2,3-dihydro-1,4-benzodioxine. InChIKey: MJGFYIAGLPOFGU-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 6-(4-ethenylphenyl)-2,3-dihydro-1,4-benzodioxine |
| InChIKey | MJGFYIAGLPOFGU-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C2=CC3=C(C=C2)OCCO3 |
Computed by PubChem (NCBI)