Products 2920875-64-3
CAS 2920875-64-3 is the registry number for 6-(4-Vinylphenyl)-2,3-dihydrobenzo[b][1,4]dioxine, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-(4-ethenylphenyl)-2,3-dihydro-1,4-benzodioxine (CAS 2920875-64-3) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 6-(4-ethenylphenyl)-2,3-dihydro-1,4-benzodioxine. InChIKey: MJGFYIAGLPOFGU-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 6-(4-ethenylphenyl)-2,3-dihydro-1,4-benzodioxine |
| InChIKey | MJGFYIAGLPOFGU-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C2=CC3=C(C=C2)OCCO3 |
Computed by PubChem (NCBI)