cas: 885522-60-1 — see every product listed under this CAS number, including other names
6-(Methoxycarbonyl)-1H-indazole-3-carboxylic acid, 97%, 97% (CAS 885522-60-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119BSL-100mg |
| cas | 885522-60-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 500mg | 539.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-methoxycarbonyl-1H-indazole-3-carboxylic acid (CAS 885522-60-1) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 6-methoxycarbonyl-1H-indazole-3-carboxylic acid. InChIKey: AZTKLZPDTBASOO-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 6-methoxycarbonyl-1H-indazole-3-carboxylic acid |
| InChIKey | AZTKLZPDTBASOO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)