cas: 5332-25-2 — see every product listed under this CAS number, including other names
6-Bromoquinoline 98% (CAS 5332-25-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A274130-5g |
| cas | 5332-25-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 359.25 Pln | |
| Ambeed | 500g | 1505.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A274130 |
6-bromoquinoline (CAS 5332-25-2) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 6-bromoquinoline. InChIKey: IFIHYLCUKYCKRH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 6-bromoquinoline |
| InChIKey | IFIHYLCUKYCKRH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)N=C1 |
Computed by PubChem (NCBI)