cas: 5332-25-2 — see every product listed under this CAS number, including other names
6-Bromoquinoline, 98%, 98% (CAS 5332-25-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145CI-5g |
| cas | 5332-25-2 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 50g | 117.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 250g | 333.20 Pln | |
| Chemat | 500g | 676.80 Pln | |
| Chemat | 1kg | 1269.20 Pln | |
| Chemat | 5kg | 4896.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromoquinoline (CAS 5332-25-2) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 6-bromoquinoline. InChIKey: IFIHYLCUKYCKRH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 6-bromoquinoline |
| InChIKey | IFIHYLCUKYCKRH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)N=C1 |
Computed by PubChem (NCBI)