cas: 53977-19-8 — see every product listed under this CAS number, including other names
6-Chloro-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid, 95+%, 95+% (CAS 53977-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0GQ-100mg |
| cas | 53977-19-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 765.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
6-chloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 53977-19-8) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 6-chloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: CDPXSMNKRFLXHU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 6-chloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | CDPXSMNKRFLXHU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)