6-Methoxypyridine-3-sulfonyl chloride, 95%
cas: 312300-42-8 — see every product listed under this CAS number, including other names
6-Methoxypyridine-3-sulfonyl chloride, 95% (CAS 312300-42-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238766-250MG |
| cas | 312300-42-8 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 872.63 Pln | |
| Fluorochem | 25g | 1580.71 Pln | |
| Fluorochem | 100g | 5860.45 Pln | |
| Fluorochem | 250g | 11254.39 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxypyridine-3-sulfonyl chloride (CAS 312300-42-8) is a chemical compound with the molecular formula C6H6ClNO3S and a molecular weight of 207.64 g/mol. IUPAC name: 6-methoxypyridine-3-sulfonyl chloride. InChIKey: OMLIVJOTRYWHNY-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S |
|---|---|
| Molecular weight | 207.64 g/mol |
| IUPAC name | 6-methoxypyridine-3-sulfonyl chloride |
| InChIKey | OMLIVJOTRYWHNY-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)