cas: 4965-36-0 — see every product listed under this CAS number, including other names
7-Bromoquinoline, >98.0%(GC)(T) (CAS 4965-36-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4155-1G |
| cas | 4965-36-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 246.19 Pln | |
| TCI | 5g | 762.50 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
7-bromoquinoline (CAS 4965-36-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 7-bromoquinoline. InChIKey: XYBSZCUHOLWQQU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 7-bromoquinoline |
| InChIKey | XYBSZCUHOLWQQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Br)N=C1 |
Computed by PubChem (NCBI)