cas: 4965-36-0 — see every product listed under this CAS number, including other names
7-Bromoquinoline, 99.95% (CAS 4965-36-0) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W004432-25 g |
| cas | 4965-36-0 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 407.93 Pln | |
| MedChemExpress | 10 g | 263.96 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.95% |
7-bromoquinoline (CAS 4965-36-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 7-bromoquinoline. InChIKey: XYBSZCUHOLWQQU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 7-bromoquinoline |
| InChIKey | XYBSZCUHOLWQQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Br)N=C1 |
Computed by PubChem (NCBI)