CAS 57278-46-3 appears in our catalog under these names: 7-Chloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 97%, 97%, 7-Chloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 57278-46-3) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 7-chloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: SACLIBNEKWTDEG-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 7-chloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | SACLIBNEKWTDEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)