CAS 86-47-5 appears in our catalog under these names: Hydroxychloroquine Impurity 13, 7-Chloro-4-hydroxyquinoline-3-carboxylic Acid, >95% (HPLC), 7-Chloro-4-hydroxyquinoline-3-carboxylic acid, 7-Chloro-4-hydroxyquinoline-3-carboxylic Acid, 95%, 95%, 7-Chloro-4-hydroxyquinoline-3-carboxylic acid, 95%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 1g, 500mg, 2000mg, 1000mg, 5000mg, 10000mg.
7-chloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 86-47-5) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 7-chloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: SACLIBNEKWTDEG-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 7-chloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | SACLIBNEKWTDEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)