cas: 16567-18-3 — see every product listed under this CAS number, including other names
8-Bromo-quinoline, 96% (CAS 16567-18-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 20g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040578-1G |
| cas | 16567-18-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 20g | 169.75 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 419.66 Pln | |
| Fluorochem | 500g | 1893.10 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
8-bromoquinoline (CAS 16567-18-3) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 8-bromoquinoline. InChIKey: PIWNKSHCLTZKSZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 8-bromoquinoline |
| InChIKey | PIWNKSHCLTZKSZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=CC=C2 |
Computed by PubChem (NCBI)