cas: 16567-18-3 — see every product listed under this CAS number, including other names
8-Bromoquinoline, >95.0%(GC)(T) (CAS 16567-18-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3421-5G |
| cas | 16567-18-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 221.61 Pln | |
| TCI | 25g | 506.81 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC)(T) |
8-bromoquinoline (CAS 16567-18-3) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 8-bromoquinoline. InChIKey: PIWNKSHCLTZKSZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 8-bromoquinoline |
| InChIKey | PIWNKSHCLTZKSZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=CC=C2 |
Computed by PubChem (NCBI)