8-Bromoisoquinoline, 95%
cas: 63927-22-0 — see every product listed under this CAS number, including other names
8-Bromoisoquinoline, 95% (CAS 63927-22-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038559-1G |
| cas | 63927-22-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 1091.30 Pln | |
| Fluorochem | 500g | 5214.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
8-bromoisoquinoline (CAS 63927-22-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 8-bromoisoquinoline. InChIKey: DPRIHFQFWWCIGY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 8-bromoisoquinoline |
| InChIKey | DPRIHFQFWWCIGY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)Br |
Computed by PubChem (NCBI)