cas: 63927-22-0 — see every product listed under this CAS number, including other names
8-Bromoisoquinoline, 99.96% (CAS 63927-22-0) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10mM/1mL, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-69089-5 g |
| cas | 63927-22-0 |
| size | 5 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 10 g | 277.90 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.96% |
8-bromoisoquinoline (CAS 63927-22-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 8-bromoisoquinoline. InChIKey: DPRIHFQFWWCIGY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 8-bromoisoquinoline |
| InChIKey | DPRIHFQFWWCIGY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)Br |
Computed by PubChem (NCBI)