cas: 1578245-95-0 — see every product listed under this CAS number, including other names
8-Chloro-2-(methylsulfanyl)pyrido[3,4-d]pyrimidine, 97%, 97% (CAS 1578245-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL95-100mg |
| cas | 1578245-95-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 1317.20 Pln | |
| Chemat | 1g | 3794.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine (CAS 1578245-95-0) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine. InChIKey: QMICGHGYKZQSQO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine |
| InChIKey | QMICGHGYKZQSQO-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C=CN=C(C2=N1)Cl |
Computed by PubChem (NCBI)