cas: 28320-62-9 — see every product listed under this CAS number, including other names
9,9-Dimethyl-9H-fluorene-2-carboxylic acid, 95+%, 95+% (CAS 28320-62-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NJT-100mg |
| cas | 28320-62-9 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 846.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
9,9-dimethylfluorene-2-carboxylic acid (CAS 28320-62-9) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 9,9-dimethylfluorene-2-carboxylic acid. InChIKey: SJIBSIBHNJAUOR-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 9,9-dimethylfluorene-2-carboxylic acid |
| InChIKey | SJIBSIBHNJAUOR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)