cas: 28320-62-9 — see every product listed under this CAS number, including other names
9,9-Dimethylfluorene-2-carboxylic Acid, >98.0%(GC)(T) (CAS 28320-62-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3332-1G |
| cas | 28320-62-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 910.02 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
9,9-dimethylfluorene-2-carboxylic acid (CAS 28320-62-9) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 9,9-dimethylfluorene-2-carboxylic acid. InChIKey: SJIBSIBHNJAUOR-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 9,9-dimethylfluorene-2-carboxylic acid |
| InChIKey | SJIBSIBHNJAUOR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)