9,9-Dimethyl-9H-fluorene-2-carboxylic acid, 95+%
cas: 28320-62-9 — see every product listed under this CAS number, including other names
9,9-Dimethyl-9H-fluorene-2-carboxylic acid, 95+% (CAS 28320-62-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A464668-250mg |
| cas | 28320-62-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 926.62 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 1g | 1851.45 Pln | |
| Fluorochem | 250mg | 778.91 Pln | |
| BLDpharm | 100mg | 258.82 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 991.90 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
9,9-dimethylfluorene-2-carboxylic acid (CAS 28320-62-9) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 9,9-dimethylfluorene-2-carboxylic acid. InChIKey: SJIBSIBHNJAUOR-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 9,9-dimethylfluorene-2-carboxylic acid |
| InChIKey | SJIBSIBHNJAUOR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)