cas: 34824-20-9 — see every product listed under this CAS number, including other names
Anthracene-1,8-diyldimethanol, 98% (CAS 34824-20-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 200mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F721630-50MG |
| cas | 34824-20-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 414.46 Pln | |
| Fluorochem | 200mg | 1231.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[8-(hydroxymethyl)anthracen-1-yl]methanol (CAS 34824-20-9) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: [8-(hydroxymethyl)anthracen-1-yl]methanol. InChIKey: GSHJWFSWKUADLL-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | [8-(hydroxymethyl)anthracen-1-yl]methanol |
| InChIKey | GSHJWFSWKUADLL-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=C2C(=C1)CO)C(=CC=C3)CO |
Computed by PubChem (NCBI)