cas: 34824-20-9 — see every product listed under this CAS number, including other names
Anthracene-1,8-diyldimethanol (CAS 34824-20-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 200mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DRU-50mg |
| cas | 34824-20-9 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 266.00 Pln | |
| Chemat | 200mg | 760.40 Pln | |
| Chemat | 1g | 2248.40 Pln |
| delivery time | 3 weeks |
|---|
[8-(hydroxymethyl)anthracen-1-yl]methanol (CAS 34824-20-9) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: [8-(hydroxymethyl)anthracen-1-yl]methanol. InChIKey: GSHJWFSWKUADLL-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | [8-(hydroxymethyl)anthracen-1-yl]methanol |
| InChIKey | GSHJWFSWKUADLL-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=C2C(=C1)CO)C(=CC=C3)CO |
Computed by PubChem (NCBI)