cas: 6094-36-6 — see every product listed under this CAS number, including other names
Benzoyl-L-glutamic acid (CAS 6094-36-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SQT-1g |
| cas | 6094-36-6 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 100g | 578.00 Pln |
| delivery time | 3 weeks |
|---|
(2S)-2-benzamidopentanedioic acid (CAS 6094-36-6) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (2S)-2-benzamidopentanedioic acid. InChIKey: LPJXPACOXRZCCP-VIFPVBQESA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2S)-2-benzamidopentanedioic acid |
| InChIKey | LPJXPACOXRZCCP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)