cas: 6094-36-6 — see every product listed under this CAS number, including other names
Bz-Glu-OH 98% (CAS 6094-36-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A784189-5g |
| cas | 6094-36-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 960.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A784189 |
(2S)-2-benzamidopentanedioic acid (CAS 6094-36-6) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (2S)-2-benzamidopentanedioic acid. InChIKey: LPJXPACOXRZCCP-VIFPVBQESA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2S)-2-benzamidopentanedioic acid |
| InChIKey | LPJXPACOXRZCCP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)