Benzyl 1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 95%
cas: 1215021-54-7 — see every product listed under this CAS number, including other names
Benzyl 1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 95% (CAS 1215021-54-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A681655-1g |
| cas | 1215021-54-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2105.88 Pln | |
| Ambeed | 10g | 3668.94 Pln | |
| BLDpharm | 1g | 791.97 Pln | |
| BLDpharm | 5g | 2235.90 Pln | |
| BLDpharm | 10g | 3929.75 Pln | |
| Chemat | 1g | 770.00 Pln | |
| Chemat | 5g | 2176.40 Pln | |
| Chemat | 10g | 3822.80 Pln | |
| Fluorochem | 1g | 1424.52 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Benzyl 2,2-dioxooxathiazolidine-3-carboxylate (CAS 1215021-54-7) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: benzyl 2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: JJRUJESEFSYUEZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | benzyl 2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | JJRUJESEFSYUEZ-UHFFFAOYSA-N |
| SMILES | C1COS(=O)(=O)N1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)