cas: 171820-74-9 — see every product listed under this CAS number, including other names
Boc-Orn(Aloc)-OH 98% (CAS 171820-74-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151575-1g |
| cas | 171820-74-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 320.31 Pln | |
| Ambeed | 25g | 720.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A151575 |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)pentanoic acid (CAS 171820-74-9) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)pentanoic acid. InChIKey: OSIUYHBPBBOKMJ-JTQLQIEISA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(prop-2-enoxycarbonylamino)pentanoic acid |
| InChIKey | OSIUYHBPBBOKMJ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)OCC=C)C(=O)O |
Computed by PubChem (NCBI)