cas: 67843-72-5 — see every product listed under this CAS number, including other names
Cbz-D-β-HoAla-OH 97% (CAS 67843-72-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A370128-250mg |
| cas | 67843-72-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 1271.50 Pln | |
| Ambeed | 100g | 4809.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A370128 |
(3R)-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 67843-72-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (3R)-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: HYWJKPFAIAWVHP-SECBINFHSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (3R)-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | HYWJKPFAIAWVHP-SECBINFHSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)