cas: 4515-23-5 — see every product listed under this CAS number, including other names
Cbz-L-Aspartic anhydride (CAS 4515-23-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009503-5 g |
| cas | 4515-23-5 |
| size | 5 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 951.28 Pln | |
| MedChemExpress | 10 g | 1443.54 Pln | |
| MedChemExpress | 25 g | 2502.37 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | no data |
Benzyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate (CAS 4515-23-5) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: benzyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate. InChIKey: OZPYEGOBGWQOSZ-VIFPVBQESA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | benzyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate |
| InChIKey | OZPYEGOBGWQOSZ-VIFPVBQESA-N |
| SMILES | C1[C@@H](C(=O)OC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)