Products 40306-01-2

CAS 40306-01-2 is the registry number for 1-(4-Carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 40306-01-2) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 1-(4-carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: UZECZYSJVJKQKO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO5
Molecular weight249.22 g/mol
IUPAC name1-(4-carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyUZECZYSJVJKQKO-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC=C(C=C2)C(=O)O)C(=O)O

Computed by PubChem (NCBI)